C16H13ClO2 — CID 804880
(2S)-2-(2-chlorophenyl)-6-methyl-2,3-dihydrochromen-4-one (PubChem CID 804880) has the molecular formula C16H13ClO2 and a molecular weight of 272.73 g/mol. Its IUPAC name is (2S)-2-(2-chlorophenyl)-6-methyl-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-2-(2-chlorophenyl)-6-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 804880 |
| Molecular Formula | C16H13ClO2 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | (2S)-2-(2-chlorophenyl)-6-methyl-2,3-dihydrochromen-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)C[C@@H](c1ccccc1Cl)O2 |
| InChI | InChI=1S/C16H13ClO2/c1-10-6-7-15-12(8-10)14(18)9-16(19-15)11-4-2-3-5-13(11)17/h2-8,16H,9H2,1H3/t16-/m0/s1 |
| InChIKey | CSLHIUUMNJOKKV-INIZCTEOSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |