C18H18O2 — CID 114673641
2-(4-ethylphenyl)-6-methyl-2,3-dihydrochromen-4-one (PubChem CID 114673641) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-6-methyl-2,3-dihydrochromen-4-one.
| Compound Name | 2-(4-ethylphenyl)-6-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114673641 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(4-ethylphenyl)-6-methyl-2,3-dihydrochromen-4-one |
| SMILES | CCc1ccc(C2CC(=O)c3cc(C)ccc3O2)cc1 |
| InChI | InChI=1S/C18H18O2/c1-3-13-5-7-14(8-6-13)18-11-16(19)15-10-12(2)4-9-17(15)20-18/h4-10,18H,3,11H2,1-2H3 |
| InChIKey | WHWXJPUKIWHJMM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |