C18H20O2 — CID 104950688
(4S)-2-(4-ethylphenyl)-6-methyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104950688) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (4S)-2-(4-ethylphenyl)-6-methyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-2-(4-ethylphenyl)-6-methyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104950688 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (4S)-2-(4-ethylphenyl)-6-methyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CCc1ccc(C2C[C@H](O)c3cc(C)ccc3O2)cc1 |
| InChI | InChI=1S/C18H20O2/c1-3-13-5-7-14(8-6-13)18-11-16(19)15-10-12(2)4-9-17(15)20-18/h4-10,16,18-19H,3,11H2,1-2H3/t16-,18?/m0/s1 |
| InChIKey | HZXPQJKFFAGGKV-ATNAJCNCSA-N |
| XLogP | 4.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |