C16H15ClO2 — CID 114715194
2-(4-chlorophenyl)-6-methyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114715194) has the molecular formula C16H15ClO2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-methyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-(4-chlorophenyl)-6-methyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114715194 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-(4-chlorophenyl)-6-methyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | Cc1ccc2c(c1)C(O)CC(c1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C16H15ClO2/c1-10-2-7-15-13(8-10)14(18)9-16(19-15)11-3-5-12(17)6-4-11/h2-8,14,16,18H,9H2,1H3 |
| InChIKey | RDKCQMAJDDIMBN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |