C12H16O2 — CID 117283229
1-(2-methyl-3,4-dihydro-2H-chromen-7-yl)ethanol (PubChem CID 117283229) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-(2-methyl-3,4-dihydro-2H-chromen-7-yl)ethanol.
| Compound Name | 1-(2-methyl-3,4-dihydro-2H-chromen-7-yl)ethanol |
|---|---|
| PubChem CID | 117283229 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 1-(2-methyl-3,4-dihydro-2H-chromen-7-yl)ethanol |
| SMILES | CC1CCc2ccc(C(C)O)cc2O1 |
| InChI | InChI=1S/C12H16O2/c1-8-3-4-10-5-6-11(9(2)13)7-12(10)14-8/h5-9,13H,3-4H2,1-2H3 |
| InChIKey | SOMIHBFZZIOZEG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |