C12H17NO3 — CID 145134038
methoxy-[(2R)-2-methyl-2,3,4,5-tetrahydro-1,4-benzoxazepin-8-yl]methanol (PubChem CID 145134038) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methoxy-[(2R)-2-methyl-2,3,4,5-tetrahydro-1,4-benzoxazepin-8-yl]methanol.
| Compound Name | methoxy-[(2R)-2-methyl-2,3,4,5-tetrahydro-1,4-benzoxazepin-8-yl]methanol |
|---|---|
| PubChem CID | 145134038 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methoxy-[(2R)-2-methyl-2,3,4,5-tetrahydro-1,4-benzoxazepin-8-yl]methanol |
| SMILES | COC(O)c1ccc2c(c1)O[C@H](C)CNC2 |
| InChI | InChI=1S/C12H17NO3/c1-8-6-13-7-10-4-3-9(12(14)15-2)5-11(10)16-8/h3-5,8,12-14H,6-7H2,1-2H3/t8-,12?/m1/s1 |
| InChIKey | SNAQMMWNOSGXGR-SZSXPDSJSA-N |
| XLogP | 1.19 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|