C11H14N2O2 — CID 122440237
2-methyl-2,3,4,5-tetrahydro-1,4-benzoxazepine-8-carboxamide (PubChem CID 122440237) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-methyl-2,3,4,5-tetrahydro-1,4-benzoxazepine-8-carboxamide.
| Compound Name | 2-methyl-2,3,4,5-tetrahydro-1,4-benzoxazepine-8-carboxamide |
|---|---|
| PubChem CID | 122440237 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-methyl-2,3,4,5-tetrahydro-1,4-benzoxazepine-8-carboxamide |
| SMILES | CC1CNCc2ccc(C(N)=O)cc2O1 |
| InChI | InChI=1S/C11H14N2O2/c1-7-5-13-6-9-3-2-8(11(12)14)4-10(9)15-7/h2-4,7,13H,5-6H2,1H3,(H2,12,14) |
| InChIKey | STOHGDQFFVLQQM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |