C10H11NO3 — CID 137423429
2-ethyl-1,3-benzodioxole-5-carboxamide (PubChem CID 137423429) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 2-ethyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | 2-ethyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 137423429 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-ethyl-1,3-benzodioxole-5-carboxamide |
| SMILES | CCC1Oc2ccc(C(N)=O)cc2O1 |
| InChI | InChI=1S/C10H11NO3/c1-2-9-13-7-4-3-6(10(11)12)5-8(7)14-9/h3-5,9H,2H2,1H3,(H2,11,12) |
| InChIKey | YZSDICTWQMQLKH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |