C20H21NO3 — CID 146371377
2-[(4Z,6E,8E)-dodeca-1,4,6,8,11-pentaen-4-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 146371377) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[(4Z,6E,8E)-dodeca-1,4,6,8,11-pentaen-4-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | 2-[(4Z,6E,8E)-dodeca-1,4,6,8,11-pentaen-4-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 146371377 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[(4Z,6E,8E)-dodeca-1,4,6,8,11-pentaen-4-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | C=CC/C=C/C=C/C=C(/CC=C)C1Oc2ccc(C(N)=O)cc2O1 |
| InChI | InChI=1S/C20H21NO3/c1-3-5-6-7-8-9-11-15(10-4-2)20-23-17-13-12-16(19(21)22)14-18(17)24-20/h3-4,6-9,11-14,20H,1-2,5,10H2,(H2,21,22)/b7-6+,9-8+,15-11- |
| InChIKey | XGTFKOJCABRINS-GYBVKVNPSA-N |
| XLogP | 4.07 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|