C27H32N2O3S — CID 146371329
2-dodeca-1,4,6,8,11-pentaen-4-yl-6-(2-morpholin-4-ylethoxy)-1-benzothiophene-5-carboxamide (PubChem CID 146371329) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is 2-dodeca-1,4,6,8,11-pentaen-4-yl-6-(2-morpholin-4-ylethoxy)-1-benzothiophene-5-carboxamide.
| Compound Name | 2-dodeca-1,4,6,8,11-pentaen-4-yl-6-(2-morpholin-4-ylethoxy)-1-benzothiophene-5-carboxamide |
|---|---|
| PubChem CID | 146371329 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-dodeca-1,4,6,8,11-pentaen-4-yl-6-(2-morpholin-4-ylethoxy)-1-benzothiophene-5-carboxamide |
| SMILES | C=CCC=CC=CC=C(CC=C)c1cc2cc(C(N)=O)c(OCCN3CCOCC3)cc2s1 |
| InChI | InChI=1S/C27H32N2O3S/c1-3-5-6-7-8-9-11-21(10-4-2)25-19-22-18-23(27(28)30)24(20-26(22)33-25)32-17-14-29-12-15-31-16-13-29/h3-4,6-9,11,18-20H,1-2,5,10,12-17H2,(H2,28,30) |
| InChIKey | ZYIGLZBVHKOMDV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|