C29H34N2O3 — CID 146371397
1-dodeca-2,4,6,9,11-pentaen-2-yl-3-(2-morpholin-4-ylethoxy)naphthalene-2-carboxamide (PubChem CID 146371397) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is 1-dodeca-2,4,6,9,11-pentaen-2-yl-3-(2-morpholin-4-ylethoxy)naphthalene-2-carboxamide.
| Compound Name | 1-dodeca-2,4,6,9,11-pentaen-2-yl-3-(2-morpholin-4-ylethoxy)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 146371397 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 1-dodeca-2,4,6,9,11-pentaen-2-yl-3-(2-morpholin-4-ylethoxy)naphthalene-2-carboxamide |
| SMILES | C=CC=CCC=CC=CC=C(C)c1c(C(N)=O)c(OCCN2CCOCC2)cc2ccccc12 |
| InChI | InChI=1S/C29H34N2O3/c1-3-4-5-6-7-8-9-10-13-23(2)27-25-15-12-11-14-24(25)22-26(28(27)29(30)32)34-21-18-31-16-19-33-20-17-31/h3-5,7-15,22H,1,6,16-21H2,2H3,(H2,30,32) |
| InChIKey | CBISAMKAEQBOSX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|