C26H27N3O3S — CID 146346236
1-(1,3-benzothiazol-2-yl)-3-(4-morpholin-4-ylbutoxy)naphthalene-2-carboxamide (PubChem CID 146346236) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-(4-morpholin-4-ylbutoxy)naphthalene-2-carboxamide.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-(4-morpholin-4-ylbutoxy)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 146346236 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-(4-morpholin-4-ylbutoxy)naphthalene-2-carboxamide |
| SMILES | NC(=O)c1c(OCCCCN2CCOCC2)cc2ccccc2c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H27N3O3S/c27-25(30)24-21(32-14-6-5-11-29-12-15-31-16-13-29)17-18-7-1-2-8-19(18)23(24)26-28-20-9-3-4-10-22(20)33-26/h1-4,7-10,17H,5-6,11-16H2,(H2,27,30) |
| InChIKey | BYPBXSUPCSXCKE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|