C17H23N5O3 — CID 169403663
5-[2-(4-morpholin-4-ylbutoxy)phenyl]-2H-triazole-4-carboxamide (PubChem CID 169403663) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-[2-(4-morpholin-4-ylbutoxy)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[2-(4-morpholin-4-ylbutoxy)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169403663 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 5-[2-(4-morpholin-4-ylbutoxy)phenyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1ccccc1OCCCCN1CCOCC1 |
| InChI | InChI=1S/C17H23N5O3/c18-17(23)16-15(19-21-20-16)13-5-1-2-6-14(13)25-10-4-3-7-22-8-11-24-12-9-22/h1-2,5-6H,3-4,7-12H2,(H2,18,23)(H,19,20,21) |
| InChIKey | VYUFOMJTMPDKGM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|