C14H16N4O3 — CID 169404622
5-[2-(oxan-4-yloxy)phenyl]-2H-triazole-4-carboxamide (PubChem CID 169404622) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 5-[2-(oxan-4-yloxy)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[2-(oxan-4-yloxy)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169404622 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5-[2-(oxan-4-yloxy)phenyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1ccccc1OC1CCOCC1 |
| InChI | InChI=1S/C14H16N4O3/c15-14(19)13-12(16-18-17-13)10-3-1-2-4-11(10)21-9-5-7-20-8-6-9/h1-4,9H,5-8H2,(H2,15,19)(H,16,17,18) |
| InChIKey | CWGMWFXBBXKPLB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |