C20H26N6O3 — CID 154567498
3-[[2-[2-(4-morpholin-4-ylbutoxy)phenyl]imidazol-1-yl]methyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 154567498) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 3-[[2-[2-(4-morpholin-4-ylbutoxy)phenyl]imidazol-1-yl]methyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[[2-[2-(4-morpholin-4-ylbutoxy)phenyl]imidazol-1-yl]methyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 154567498 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-[[2-[2-(4-morpholin-4-ylbutoxy)phenyl]imidazol-1-yl]methyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(Cn2ccnc2-c2ccccc2OCCCCN2CCOCC2)[nH]1 |
| InChI | InChI=1S/C20H26N6O3/c27-20-22-18(23-24-20)15-26-9-7-21-19(26)16-5-1-2-6-17(16)29-12-4-3-8-25-10-13-28-14-11-25/h1-2,5-7,9H,3-4,8,10-15H2,(H2,22,23,24,27) |
| InChIKey | OKBPNBKPOXUKSI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|