C31H38N2O3 — CID 146371385
1-dodeca-1,4,6,8,11-pentaen-4-yl-3-(4-morpholin-4-ylbutoxy)naphthalene-2-carboxamide (PubChem CID 146371385) has the molecular formula C31H38N2O3 and a molecular weight of 486.66 g/mol. Its IUPAC name is 1-dodeca-1,4,6,8,11-pentaen-4-yl-3-(4-morpholin-4-ylbutoxy)naphthalene-2-carboxamide.
| Compound Name | 1-dodeca-1,4,6,8,11-pentaen-4-yl-3-(4-morpholin-4-ylbutoxy)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 146371385 |
| Molecular Formula | C31H38N2O3 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | 1-dodeca-1,4,6,8,11-pentaen-4-yl-3-(4-morpholin-4-ylbutoxy)naphthalene-2-carboxamide |
| SMILES | C=CCC=CC=CC=C(CC=C)c1c(C(N)=O)c(OCCCCN2CCOCC2)cc2ccccc12 |
| InChI | InChI=1S/C31H38N2O3/c1-3-5-6-7-8-9-15-25(14-4-2)29-27-17-11-10-16-26(27)24-28(30(29)31(32)34)36-21-13-12-18-33-19-22-35-23-20-33/h3-4,6-11,15-17,24H,1-2,5,12-14,18-23H2,(H2,32,34) |
| InChIKey | SOAOKZFIXKEUCG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|