C28H29N3O5S — CID 146346240
methyl 2-[[3-(4-morpholin-4-ylbutoxy)naphthalene-2-carbonyl]amino]-1,3-benzothiazole-6-carboxylate (PubChem CID 146346240) has the molecular formula C28H29N3O5S and a molecular weight of 519.62 g/mol. Its IUPAC name is methyl 2-[[3-(4-morpholin-4-ylbutoxy)naphthalene-2-carbonyl]amino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-[[3-(4-morpholin-4-ylbutoxy)naphthalene-2-carbonyl]amino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 146346240 |
| Molecular Formula | C28H29N3O5S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | methyl 2-[[3-(4-morpholin-4-ylbutoxy)naphthalene-2-carbonyl]amino]-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(NC(=O)c3cc4ccccc4cc3OCCCCN3CCOCC3)sc2c1 |
| InChI | InChI=1S/C28H29N3O5S/c1-34-27(33)21-8-9-23-25(18-21)37-28(29-23)30-26(32)22-16-19-6-2-3-7-20(19)17-24(22)36-13-5-4-10-31-11-14-35-15-12-31/h2-3,6-9,16-18H,4-5,10-15H2,1H3,(H,29,30,32) |
| InChIKey | SCYBPWBMAUVXEC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|