C20H21N3O3S — CID 146405944
N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-morpholin-4-ylbenzamide (PubChem CID 146405944) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-morpholin-4-ylbenzamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 146405944 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-4-morpholin-4-ylbenzamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3ccc(N4CCOCC4)cc3)sc2c1 |
| InChI | InChI=1S/C20H21N3O3S/c1-2-26-16-7-8-17-18(13-16)27-20(21-17)22-19(24)14-3-5-15(6-4-14)23-9-11-25-12-10-23/h3-8,13H,2,9-12H2,1H3,(H,21,22,24) |
| InChIKey | VNLGODQDOSGIMV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |