C24H21N3O2S — CID 40613052
N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-phenylbenzamide (PubChem CID 40613052) has the molecular formula C24H21N3O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-phenylbenzamide.
| Compound Name | N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 40613052 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-phenylbenzamide |
| SMILES | O=C(Nc1nc2ccc(N3CCOCC3)cc2s1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O2S/c28-23(19-8-6-18(7-9-19)17-4-2-1-3-5-17)26-24-25-21-11-10-20(16-22(21)30-24)27-12-14-29-15-13-27/h1-11,16H,12-15H2,(H,25,26,28) |
| InChIKey | YAUHYTGJIDGFKK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |