C18H15Cl2N3O2S — CID 40613036
2,4-dichloro-N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 40613036) has the molecular formula C18H15Cl2N3O2S and a molecular weight of 408.31 g/mol. Its IUPAC name is 2,4-dichloro-N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2,4-dichloro-N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 40613036 |
| Molecular Formula | C18H15Cl2N3O2S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 2,4-dichloro-N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc2ccc(N3CCOCC3)cc2s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2N3O2S/c19-11-1-3-13(14(20)9-11)17(24)22-18-21-15-4-2-12(10-16(15)26-18)23-5-7-25-8-6-23/h1-4,9-10H,5-8H2,(H,21,22,24) |
| InChIKey | HOHWKEQIZDEXBC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |