C20H20N4O3S2 — CID 5213183
2-methoxy-N-[(6-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 5213183) has the molecular formula C20H20N4O3S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 2-methoxy-N-[(6-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 2-methoxy-N-[(6-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 5213183 |
| Molecular Formula | C20H20N4O3S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2-methoxy-N-[(6-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | COc1ccccc1C(=O)NC(=S)Nc1nc2ccc(N3CCOCC3)cc2s1 |
| InChI | InChI=1S/C20H20N4O3S2/c1-26-16-5-3-2-4-14(16)18(25)22-19(28)23-20-21-15-7-6-13(12-17(15)29-20)24-8-10-27-11-9-24/h2-7,12H,8-11H2,1H3,(H2,21,22,23,25,28) |
| InChIKey | MVYAWZMPHNGVGG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|