C21H23N3O5S — CID 42536141
methyl 5-[(2-methoxybenzoyl)carbamothioylamino]-2-morpholin-4-ylbenzoate (PubChem CID 42536141) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is methyl 5-[(2-methoxybenzoyl)carbamothioylamino]-2-morpholin-4-ylbenzoate.
| Compound Name | methyl 5-[(2-methoxybenzoyl)carbamothioylamino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 42536141 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | methyl 5-[(2-methoxybenzoyl)carbamothioylamino]-2-morpholin-4-ylbenzoate |
| SMILES | COC(=O)c1cc(NC(=S)NC(=O)c2ccccc2OC)ccc1N1CCOCC1 |
| InChI | InChI=1S/C21H23N3O5S/c1-27-18-6-4-3-5-15(18)19(25)23-21(30)22-14-7-8-17(16(13-14)20(26)28-2)24-9-11-29-12-10-24/h3-8,13H,9-12H2,1-2H3,(H2,22,23,25,30) |
| InChIKey | QQEFDNSIXOPHTE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|