C21H24N2O5 — CID 6463110
methyl 5-[(3-ethoxybenzoyl)amino]-2-morpholin-4-ylbenzoate (PubChem CID 6463110) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl 5-[(3-ethoxybenzoyl)amino]-2-morpholin-4-ylbenzoate.
| Compound Name | methyl 5-[(3-ethoxybenzoyl)amino]-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 6463110 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | methyl 5-[(3-ethoxybenzoyl)amino]-2-morpholin-4-ylbenzoate |
| SMILES | CCOc1cccc(C(=O)Nc2ccc(N3CCOCC3)c(C(=O)OC)c2)c1 |
| InChI | InChI=1S/C21H24N2O5/c1-3-28-17-6-4-5-15(13-17)20(24)22-16-7-8-19(18(14-16)21(25)26-2)23-9-11-27-12-10-23/h4-8,13-14H,3,9-12H2,1-2H3,(H,22,24) |
| InChIKey | HYQFBRCXCVQIKM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|