C18H20N2O3 — CID 795014
3-methoxy-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 795014) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-methoxy-N-(4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 3-methoxy-N-(4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 795014 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-methoxy-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-22-17-4-2-3-14(13-17)18(21)19-15-5-7-16(8-6-15)20-9-11-23-12-10-20/h2-8,13H,9-12H2,1H3,(H,19,21) |
| InChIKey | LYGBUZAVLPEGPD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|