C28H26N4O4 — CID 46386528
3-[4-(4-methoxyphenoxy)pyrimidin-2-yl]-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 46386528) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenoxy)pyrimidin-2-yl]-N-(4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 3-[4-(4-methoxyphenoxy)pyrimidin-2-yl]-N-(4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 46386528 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 3-[4-(4-methoxyphenoxy)pyrimidin-2-yl]-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | COc1ccc(Oc2ccnc(-c3cccc(C(=O)Nc4ccc(N5CCOCC5)cc4)c3)n2)cc1 |
| InChI | InChI=1S/C28H26N4O4/c1-34-24-9-11-25(12-10-24)36-26-13-14-29-27(31-26)20-3-2-4-21(19-20)28(33)30-22-5-7-23(8-6-22)32-15-17-35-18-16-32/h2-14,19H,15-18H2,1H3,(H,30,33) |
| InChIKey | QBZXCWADFULCOQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|