C31H31N5O4S — CID 25165292
N-(4-morpholin-4-ylphenyl)-4-[3-[(4-morpholin-4-ylphenyl)carbamoyl]phenyl]-1,3-thiazole-2-carboxamide (PubChem CID 25165292) has the molecular formula C31H31N5O4S and a molecular weight of 569.69 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-4-[3-[(4-morpholin-4-ylphenyl)carbamoyl]phenyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-4-[3-[(4-morpholin-4-ylphenyl)carbamoyl]phenyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 25165292 |
| Molecular Formula | C31H31N5O4S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-4-[3-[(4-morpholin-4-ylphenyl)carbamoyl]phenyl]-1,3-thiazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1cccc(-c2csc(C(=O)Nc3ccc(N4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C31H31N5O4S/c37-29(32-24-4-8-26(9-5-24)35-12-16-39-17-13-35)23-3-1-2-22(20-23)28-21-41-31(34-28)30(38)33-25-6-10-27(11-7-25)36-14-18-40-19-15-36/h1-11,20-21H,12-19H2,(H,32,37)(H,33,38) |
| InChIKey | JRHAEGBZWIIEPK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|