C28H29N5O3 — CID 67687499
N,2-bis(4-morpholin-4-ylphenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 67687499) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is N,2-bis(4-morpholin-4-ylphenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N,2-bis(4-morpholin-4-ylphenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67687499 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | N,2-bis(4-morpholin-4-ylphenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1ccc2nc(-c3ccc(N4CCOCC4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C28H29N5O3/c34-28(29-22-4-8-24(9-5-22)33-13-17-36-18-14-33)21-3-10-25-26(19-21)31-27(30-25)20-1-6-23(7-2-20)32-11-15-35-16-12-32/h1-10,19H,11-18H2,(H,29,34)(H,30,31) |
| InChIKey | NFZHWWRGKWCFBV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 82.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|