C35H35N5O4 — CID 148819854
4-[6-[2-[4-[2-hydroxyethyl(methyl)amino]phenyl]-2-oxoethyl]-1H-benzimidazol-2-yl]-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 148819854) has the molecular formula C35H35N5O4 and a molecular weight of 589.70 g/mol. Its IUPAC name is 4-[6-[2-[4-[2-hydroxyethyl(methyl)amino]phenyl]-2-oxoethyl]-1H-benzimidazol-2-yl]-N-(4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 4-[6-[2-[4-[2-hydroxyethyl(methyl)amino]phenyl]-2-oxoethyl]-1H-benzimidazol-2-yl]-N-(4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 148819854 |
| Molecular Formula | C35H35N5O4 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | 4-[6-[2-[4-[2-hydroxyethyl(methyl)amino]phenyl]-2-oxoethyl]-1H-benzimidazol-2-yl]-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | CN(CCO)c1ccc(C(=O)Cc2ccc3nc(-c4ccc(C(=O)Nc5ccc(N6CCOCC6)cc5)cc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C35H35N5O4/c1-39(16-19-41)29-11-7-25(8-12-29)33(42)23-24-2-15-31-32(22-24)38-34(37-31)26-3-5-27(6-4-26)35(43)36-28-9-13-30(14-10-28)40-17-20-44-21-18-40/h2-15,22,41H,16-21,23H2,1H3,(H,36,43)(H,37,38) |
| InChIKey | OROIKCORQBQJRH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 110.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|