C31H35N5O3 — CID 67112884
N-[2-[4-[4-(2-hydroxyethyl)piperidin-1-yl]phenyl]-3H-benzimidazol-5-yl]-4-morpholin-4-ylbenzamide (PubChem CID 67112884) has the molecular formula C31H35N5O3 and a molecular weight of 525.65 g/mol. Its IUPAC name is N-[2-[4-[4-(2-hydroxyethyl)piperidin-1-yl]phenyl]-3H-benzimidazol-5-yl]-4-morpholin-4-ylbenzamide.
| Compound Name | N-[2-[4-[4-(2-hydroxyethyl)piperidin-1-yl]phenyl]-3H-benzimidazol-5-yl]-4-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 67112884 |
| Molecular Formula | C31H35N5O3 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | N-[2-[4-[4-(2-hydroxyethyl)piperidin-1-yl]phenyl]-3H-benzimidazol-5-yl]-4-morpholin-4-ylbenzamide |
| SMILES | O=C(Nc1ccc2nc(-c3ccc(N4CCC(CCO)CC4)cc3)[nH]c2c1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C31H35N5O3/c37-18-13-22-11-14-35(15-12-22)26-6-1-23(2-7-26)30-33-28-10-5-25(21-29(28)34-30)32-31(38)24-3-8-27(9-4-24)36-16-19-39-20-17-36/h1-10,21-22,37H,11-20H2,(H,32,38)(H,33,34) |
| InChIKey | URJGGVXLSSSAKH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 93.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|