C33H35N5O3 — CID 149226429
2-[2-[4-[4-(cyclopropanecarbonyl)piperazin-1-yl]phenyl]-3H-benzimidazol-5-yl]-1-(4-morpholin-4-ylphenyl)ethanone (PubChem CID 149226429) has the molecular formula C33H35N5O3 and a molecular weight of 549.68 g/mol. Its IUPAC name is 2-[2-[4-[4-(cyclopropanecarbonyl)piperazin-1-yl]phenyl]-3H-benzimidazol-5-yl]-1-(4-morpholin-4-ylphenyl)ethanone.
| Compound Name | 2-[2-[4-[4-(cyclopropanecarbonyl)piperazin-1-yl]phenyl]-3H-benzimidazol-5-yl]-1-(4-morpholin-4-ylphenyl)ethanone |
|---|---|
| PubChem CID | 149226429 |
| Molecular Formula | C33H35N5O3 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | 2-[2-[4-[4-(cyclopropanecarbonyl)piperazin-1-yl]phenyl]-3H-benzimidazol-5-yl]-1-(4-morpholin-4-ylphenyl)ethanone |
| SMILES | O=C(Cc1ccc2nc(-c3ccc(N4CCN(C(=O)C5CC5)CC4)cc3)[nH]c2c1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C33H35N5O3/c39-31(24-4-8-28(9-5-24)37-17-19-41-20-18-37)22-23-1-12-29-30(21-23)35-32(34-29)25-6-10-27(11-7-25)36-13-15-38(16-14-36)33(40)26-2-3-26/h1,4-12,21,26H,2-3,13-20,22H2,(H,34,35) |
| InChIKey | XJLJUQBUDDOZCM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|