C29H28N6O3 — CID 67114161
4-[4-[5-[2-(4-morpholin-4-ylphenyl)-3H-benzimidazol-5-yl]-1,3,4-oxadiazol-2-yl]phenyl]morpholine (PubChem CID 67114161) has the molecular formula C29H28N6O3 and a molecular weight of 508.58 g/mol. Its IUPAC name is 4-[4-[5-[2-(4-morpholin-4-ylphenyl)-3H-benzimidazol-5-yl]-1,3,4-oxadiazol-2-yl]phenyl]morpholine.
| Compound Name | 4-[4-[5-[2-(4-morpholin-4-ylphenyl)-3H-benzimidazol-5-yl]-1,3,4-oxadiazol-2-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 67114161 |
| Molecular Formula | C29H28N6O3 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 4-[4-[5-[2-(4-morpholin-4-ylphenyl)-3H-benzimidazol-5-yl]-1,3,4-oxadiazol-2-yl]phenyl]morpholine |
| SMILES | c1cc(N2CCOCC2)ccc1-c1nc2ccc(-c3nnc(-c4ccc(N5CCOCC5)cc4)o3)cc2[nH]1 |
| InChI | InChI=1S/C29H28N6O3/c1-6-23(34-11-15-36-16-12-34)7-2-20(1)27-30-25-10-5-22(19-26(25)31-27)29-33-32-28(38-29)21-3-8-24(9-4-21)35-13-17-37-18-14-35/h1-10,19H,11-18H2,(H,30,31) |
| InChIKey | VNPYXLNADPKLOJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|