C12H14N4O2 — CID 138736841
5-(4-morpholin-4-ylphenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 138736841) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 5-(4-morpholin-4-ylphenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(4-morpholin-4-ylphenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 138736841 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 5-(4-morpholin-4-ylphenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccc(N3CCOCC3)cc2)o1 |
| InChI | InChI=1S/C12H14N4O2/c13-12-15-14-11(18-12)9-1-3-10(4-2-9)16-5-7-17-8-6-16/h1-4H,5-8H2,(H2,13,15) |
| InChIKey | SUZWPIVDXLFSFJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |