C10H11N3O — CID 18073044
5-(4-ethylphenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 18073044) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(4-ethylphenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 18073044 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 5-(4-ethylphenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCc1ccc(-c2nnc(N)o2)cc1 |
| InChI | InChI=1S/C10H11N3O/c1-2-7-3-5-8(6-4-7)9-12-13-10(11)14-9/h3-6H,2H2,1H3,(H2,11,13) |
| InChIKey | CBUONAHNWHSRMJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |