C11H13N3O — CID 45496453
5-[(4-ethylphenyl)methyl]-1,3,4-oxadiazol-2-amine (PubChem CID 45496453) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 5-[(4-ethylphenyl)methyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[(4-ethylphenyl)methyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 45496453 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5-[(4-ethylphenyl)methyl]-1,3,4-oxadiazol-2-amine |
| SMILES | CCc1ccc(Cc2nnc(N)o2)cc1 |
| InChI | InChI=1S/C11H13N3O/c1-2-8-3-5-9(6-4-8)7-10-13-14-11(12)15-10/h3-6H,2,7H2,1H3,(H2,12,14) |
| InChIKey | HVPQGHLNUROCRP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |