C16H16N4O — CID 95909479
4-[[5-[(4-aminophenyl)methyl]-1,3,4-oxadiazol-2-yl]methyl]aniline (PubChem CID 95909479) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-[[5-[(4-aminophenyl)methyl]-1,3,4-oxadiazol-2-yl]methyl]aniline.
| Compound Name | 4-[[5-[(4-aminophenyl)methyl]-1,3,4-oxadiazol-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 95909479 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 4-[[5-[(4-aminophenyl)methyl]-1,3,4-oxadiazol-2-yl]methyl]aniline |
| SMILES | Nc1ccc(Cc2nnc(Cc3ccc(N)cc3)o2)cc1 |
| InChI | InChI=1S/C16H16N4O/c17-13-5-1-11(2-6-13)9-15-19-20-16(21-15)10-12-3-7-14(18)8-4-12/h1-8H,9-10,17-18H2 |
| InChIKey | JKFLGEBMZUBOJP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|