C18H18N4O3 — CID 110456628
methyl 2-[4-[[5-[(4-aminophenyl)methyl]-1,3,4-oxadiazol-2-yl]amino]phenyl]acetate (PubChem CID 110456628) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is methyl 2-[4-[[5-[(4-aminophenyl)methyl]-1,3,4-oxadiazol-2-yl]amino]phenyl]acetate.
| Compound Name | methyl 2-[4-[[5-[(4-aminophenyl)methyl]-1,3,4-oxadiazol-2-yl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 110456628 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | methyl 2-[4-[[5-[(4-aminophenyl)methyl]-1,3,4-oxadiazol-2-yl]amino]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(Nc2nnc(Cc3ccc(N)cc3)o2)cc1 |
| InChI | InChI=1S/C18H18N4O3/c1-24-17(23)11-13-4-8-15(9-5-13)20-18-22-21-16(25-18)10-12-2-6-14(19)7-3-12/h2-9H,10-11,19H2,1H3,(H,20,22) |
| InChIKey | PKAOXWJVHARWTO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|