C18H17IN2OS — CID 92658731
2-[(4-ethylphenyl)methyl]-5-[(4-iodophenyl)methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 92658731) has the molecular formula C18H17IN2OS and a molecular weight of 436.32 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)methyl]-5-[(4-iodophenyl)methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-[(4-ethylphenyl)methyl]-5-[(4-iodophenyl)methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 92658731 |
| Molecular Formula | C18H17IN2OS |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | 2-[(4-ethylphenyl)methyl]-5-[(4-iodophenyl)methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | CCc1ccc(Cc2nnc(SCc3ccc(I)cc3)o2)cc1 |
| InChI | InChI=1S/C18H17IN2OS/c1-2-13-3-5-14(6-4-13)11-17-20-21-18(22-17)23-12-15-7-9-16(19)10-8-15/h3-10H,2,11-12H2,1H3 |
| InChIKey | MFHKIJLJRCOKOO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|