C15H11IN2OS — CID 19060735
2-benzylsulfanyl-5-(4-iodophenyl)-1,3,4-oxadiazole (PubChem CID 19060735) has the molecular formula C15H11IN2OS and a molecular weight of 394.24 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-(4-iodophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-benzylsulfanyl-5-(4-iodophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19060735 |
| Molecular Formula | C15H11IN2OS |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 2-benzylsulfanyl-5-(4-iodophenyl)-1,3,4-oxadiazole |
| SMILES | Ic1ccc(-c2nnc(SCc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C15H11IN2OS/c16-13-8-6-12(7-9-13)14-17-18-15(19-14)20-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | HMWJZGNICYNKCD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|