C36H30N6O3S3 — CID 139079587
2-phenyl-5-[[2,4,6-trimethyl-3,5-bis[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]phenyl]methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 139079587) has the molecular formula C36H30N6O3S3 and a molecular weight of 690.88 g/mol. Its IUPAC name is 2-phenyl-5-[[2,4,6-trimethyl-3,5-bis[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]phenyl]methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-phenyl-5-[[2,4,6-trimethyl-3,5-bis[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]phenyl]methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 139079587 |
| Molecular Formula | C36H30N6O3S3 |
| Molecular Weight | 690.88 g/mol |
| Exact Mass | 690.15 |
| IUPAC Name | 2-phenyl-5-[[2,4,6-trimethyl-3,5-bis[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]phenyl]methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | Cc1c(CSc2nnc(-c3ccccc3)o2)c(C)c(CSc2nnc(-c3ccccc3)o2)c(C)c1CSc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C36H30N6O3S3/c1-22-28(19-46-34-40-37-31(43-34)25-13-7-4-8-14-25)23(2)30(21-48-36-42-39-33(45-36)27-17-11-6-12-18-27)24(3)29(22)20-47-35-41-38-32(44-35)26-15-9-5-10-16-26/h4-18H,19-21H2,1-3H3 |
| InChIKey | IQLOLFZNEIKRRF-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 116.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.88 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |