C18H18N2OS — CID 56970576
2-benzylsulfanyl-5-(4-propan-2-ylphenyl)-1,3,4-oxadiazole (PubChem CID 56970576) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-(4-propan-2-ylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-benzylsulfanyl-5-(4-propan-2-ylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 56970576 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-benzylsulfanyl-5-(4-propan-2-ylphenyl)-1,3,4-oxadiazole |
| SMILES | CC(C)c1ccc(-c2nnc(SCc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C18H18N2OS/c1-13(2)15-8-10-16(11-9-15)17-19-20-18(21-17)22-12-14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3 |
| InChIKey | DIOPZPNAUDLRCJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |