C17H16ClN3OS — CID 51348485
2-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-(4-propan-2-ylphenyl)-1,3,4-oxadiazole (PubChem CID 51348485) has the molecular formula C17H16ClN3OS and a molecular weight of 345.86 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-(4-propan-2-ylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-(4-propan-2-ylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 51348485 |
| Molecular Formula | C17H16ClN3OS |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-(4-propan-2-ylphenyl)-1,3,4-oxadiazole |
| SMILES | CC(C)c1ccc(-c2nnc(SCc3ccc(Cl)nc3)o2)cc1 |
| InChI | InChI=1S/C17H16ClN3OS/c1-11(2)13-4-6-14(7-5-13)16-20-21-17(22-16)23-10-12-3-8-15(18)19-9-12/h3-9,11H,10H2,1-2H3 |
| InChIKey | MKBCTDSGZSNWES-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|