C14H10ClN3OS — CID 31048483
2-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 31048483) has the molecular formula C14H10ClN3OS and a molecular weight of 303.77 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 31048483 |
| Molecular Formula | C14H10ClN3OS |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | Clc1ccc(CSc2nnc(-c3ccccc3)o2)cn1 |
| InChI | InChI=1S/C14H10ClN3OS/c15-12-7-6-10(8-16-12)9-20-14-18-17-13(19-14)11-4-2-1-3-5-11/h1-8H,9H2 |
| InChIKey | NGIKXLJFSXBROM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|