C14H9ClFN3OS — CID 51348336
2-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-(2-fluorophenyl)-1,3,4-oxadiazole (PubChem CID 51348336) has the molecular formula C14H9ClFN3OS and a molecular weight of 321.76 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-(2-fluorophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-(2-fluorophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 51348336 |
| Molecular Formula | C14H9ClFN3OS |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methylsulfanyl]-5-(2-fluorophenyl)-1,3,4-oxadiazole |
| SMILES | Fc1ccccc1-c1nnc(SCc2ccc(Cl)nc2)o1 |
| InChI | InChI=1S/C14H9ClFN3OS/c15-12-6-5-9(7-17-12)8-21-14-19-18-13(20-14)10-3-1-2-4-11(10)16/h1-7H,8H2 |
| InChIKey | BIPOMABEEHSDAM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|