C15H10Cl2N2OS — CID 562598
2-benzylsulfanyl-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole (PubChem CID 562598) has the molecular formula C15H10Cl2N2OS and a molecular weight of 337.23 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-benzylsulfanyl-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 562598 |
| Molecular Formula | C15H10Cl2N2OS |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 2-benzylsulfanyl-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole |
| SMILES | Clc1ccc(-c2nnc(SCc3ccccc3)o2)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N2OS/c16-11-6-7-12(13(17)8-11)14-18-19-15(20-14)21-9-10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | DAWVIXYYTGKMBG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |