C17H13N3OS — CID 858959
2-benzylsulfanyl-5-(1H-indol-3-yl)-1,3,4-oxadiazole (PubChem CID 858959) has the molecular formula C17H13N3OS and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-(1H-indol-3-yl)-1,3,4-oxadiazole.
| Compound Name | 2-benzylsulfanyl-5-(1H-indol-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 858959 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-benzylsulfanyl-5-(1H-indol-3-yl)-1,3,4-oxadiazole |
| SMILES | c1ccc(CSc2nnc(-c3c[nH]c4ccccc34)o2)cc1 |
| InChI | InChI=1S/C17H13N3OS/c1-2-6-12(7-3-1)11-22-17-20-19-16(21-17)14-10-18-15-9-5-4-8-13(14)15/h1-10,18H,11H2 |
| InChIKey | MOVDKHAIOCRVHH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |