C13H13N3OS — CID 135667478
2-(1H-indol-3-yl)-5-propan-2-ylsulfanyl-1,3,4-oxadiazole (PubChem CID 135667478) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-5-propan-2-ylsulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-(1H-indol-3-yl)-5-propan-2-ylsulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 135667478 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-(1H-indol-3-yl)-5-propan-2-ylsulfanyl-1,3,4-oxadiazole |
| SMILES | CC(C)Sc1nnc(-c2c[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C13H13N3OS/c1-8(2)18-13-16-15-12(17-13)10-7-14-11-6-4-3-5-9(10)11/h3-8,14H,1-2H3 |
| InChIKey | BSZQYXRCLPSIJE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |