C20H17N5O3S — CID 135798288
N'-[(2S)-2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanoyl]benzohydrazide (PubChem CID 135798288) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is N'-[(2S)-2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanoyl]benzohydrazide.
| Compound Name | N'-[(2S)-2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 135798288 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N'-[(2S)-2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanoyl]benzohydrazide |
| SMILES | C[C@H](Sc1nnc(-c2c[nH]c3ccccc23)o1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17N5O3S/c1-12(17(26)22-23-18(27)13-7-3-2-4-8-13)29-20-25-24-19(28-20)15-11-21-16-10-6-5-9-14(15)16/h2-12,21H,1H3,(H,22,26)(H,23,27)/t12-/m0/s1 |
| InChIKey | HLPQOLZQJWTPMA-LBPRGKRZSA-N |
| XLogP | 3.16 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|