C15H11FN2OS — CID 53495022
2-benzylsulfanyl-5-(3-fluorophenyl)-1,3,4-oxadiazole (PubChem CID 53495022) has the molecular formula C15H11FN2OS and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-(3-fluorophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-benzylsulfanyl-5-(3-fluorophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 53495022 |
| Molecular Formula | C15H11FN2OS |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-benzylsulfanyl-5-(3-fluorophenyl)-1,3,4-oxadiazole |
| SMILES | Fc1cccc(-c2nnc(SCc3ccccc3)o2)c1 |
| InChI | InChI=1S/C15H11FN2OS/c16-13-8-4-7-12(9-13)14-17-18-15(19-14)20-10-11-5-2-1-3-6-11/h1-9H,10H2 |
| InChIKey | HEYNZIONDZUEGU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |