C16H11N3OS — CID 53495040
3-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)benzonitrile (PubChem CID 53495040) has the molecular formula C16H11N3OS and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)benzonitrile.
| Compound Name | 3-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 53495040 |
| Molecular Formula | C16H11N3OS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 3-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2nnc(SCc3ccccc3)o2)c1 |
| InChI | InChI=1S/C16H11N3OS/c17-10-13-7-4-8-14(9-13)15-18-19-16(20-15)21-11-12-5-2-1-3-6-12/h1-9H,11H2 |
| InChIKey | SLXGNRNHPIUNRY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |