C15H12N2OS2 — CID 155545609
2-(benzyldisulfanyl)-5-phenyl-1,3,4-oxadiazole (PubChem CID 155545609) has the molecular formula C15H12N2OS2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-(benzyldisulfanyl)-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-(benzyldisulfanyl)-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 155545609 |
| Molecular Formula | C15H12N2OS2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-(benzyldisulfanyl)-5-phenyl-1,3,4-oxadiazole |
| SMILES | c1ccc(CSSc2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C15H12N2OS2/c1-3-7-12(8-4-1)11-19-20-15-17-16-14(18-15)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | FAWQSSCMYYALOM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|